2. Articole
Permanent URI for this collectionhttps://msuir.usm.md/handle/123456789/46
Browse
7 results
Search Results
Item Synthesis, structure and properties of complex compounds of cobalt, nickel, copper and zinc with 2-formylpyridine semicarbazone [Articol](2009) Gulea, Aurelian; Gînju, Dumitru; Bairac, Natalia; Poirier, Donald; Țapcov, Victor2-Formylpyridine semicarbazone L reacts with cobalt, nickel, copper and zinc chlorides, nitrates and perchlorites to form coordination compounds of compositions ML2X2•nH2O (M=Co, Ni, Cu, Zn; X = Cl, NO3, ClO4; L = NC5H 4-CH=N-NH-C(O)-NH2; n = 0, 1) and CuLX2• nH2O (X = Cl, Br, NO3; n = 0-0.5). Complex CuL(NO 3)2 has polynuclear, CuLX2•0.5H 2O (X = Cl, Br), binuclear, and other compounds, mononuclear structures. Azomethine L behaves in them as tridental N,N,O-ligand. Thermolysis of these complexes proceeds through such stages as dehydration (80-95°C), deactivation (145-155°C) and complete theral degradation (170-590°C). Complexes CuLX2•nH2O (X = Cl, NO3; n = 0-0.5) were established to inhibit in vitro the growth and reproduction of 100% of cancer cells of human mieloid leukaemia HL-60 at 10-4 M concentration. At 10-5 M concentration they inhibit only 10% of cells, and at 10-6 M concentration they do not possess anticancer activity.Item Sulfanylamide-containing coordination compounds of 3d-elements with 2,4-pentanedione bis-thiosemicarbazone and bis-4-phenylthiosemicarbazone [Articol](2008) Gulea, Aurelian; Spînu, S.; Țapcov, Victor; Poirier, DonaldThiosemicarbazide and 4-phenylthiosemicarbazide react in ethanol with 2,4-pentanedione in the presence of manganese, cobalt, nickel, copper, and zinc acetates hydrates and streptamin (Sf1), sulfaethidole (Sf 2), and sulfadimidine (Sf3) to form coordination compounds of the composition M(Sf1-3)(L1-2)·nH2O (M = Mn, Co, Ni, Cu, Zn; H2L1 is 2,4-pentanedione bis-thiosemicarbazone, H2L2 is 2,4-pentanedione bis-4-phenylthiosemicarbazone; n = 0-6). All the complexes synthesized are monomeric. Thiosemicarbazones (H2L1 and H 2L2) behave as twice deprotonated S,N,N,S-tetradentate ligands, while sulfanylamides (Sf1-3) act as monodentate ones. Thermolysis of these substances proceeds through the stages of dehydration (65-95°C) and complete thermal decomposition (430-560°C). It is found that the complex [Cu(Sf2)(L1)]·4H2O in the concentration 10-5 M inhibits the growth and fission of 100% cancer cells of the human myeloid leukemia (HL-60).Item COORDINATION COMPOUNDS OF COPPER WITH 2-FORMYLPYRIDINE 4-(DIMETHYLPHENYL)THIOSEMICARBAZONES(2012) Gulea, Aurelian; Lozan-Tîrșu, Carolina; Țapcov, Victor; Corja, Ion; Rudic, Valeriu2-Formylpyridine 4-(2,6-dimethylphenyl)-(HL1), 4-(2,5-dimethylphenyl)-(HL2), 4-(3,4-dimethylphenyl)-(HL 3), and 4-(2,4-dimethylphenyl)thiosemicarbazones (HL4) react with copper chloride and nitrate to form coordination compounds CuL 1-4X·nH2O [X = Cl-, NO3 -; n = 1, 2]. All compounds have a polynuclear structure. Azomethines HL1-4 act as the bridging monodeprotonated tridentate N,N,S-ligands. The thermolysis of the complexes includes the dehydration (70-90 C) and total thermal decomposition (350-520 C). The complexes synthesized exhibit a selective antimicrobial activity against a series of standard strains of Staphylococcus aureus and Escherichia coli in the concentration range of 0.009-37.5 μg ml-1Item COORDINATION COMPOUNDS OF COBALT, NICKEL, COPPER, AND ZINC WITH 2-BROMO-3-PHENYLPROPENAL BENZOYLHYDRAZONE AND THIOSEMICARBAZONE(2009) Samusi, Nina; Ciumacov, Iurie; Țapcov, Victor; Bocelli, Gabrielle; Simonov, Iurie; Gulea, AurelianBy X-ray structural analysis the crystal structure of 2-bromo-3- phenylpropenal benzoylhydrazone (HL) was determined. The molecule is not flat. In the crystal the HL molecules form infinite chains with reciprocal van der Waals interaction. 2-Bromo-3-phenylpropenal hydrazone (HL) and thiosemicarbazone (HL') react with cobalt, nickel, copper and zinc chlorides, nitrates and acetates to form coordination compounds of the composition Cu(HL)(L)2 [HL = C6H5-CH=CBr-CH=N-NH-C(O)-C6H 5], MX2•2 HL'•nH2O [M = Co, Ni, Cu, Zn; X = Cl, NO3, HL' = C6H5-CH=CBr-CH=N-NH-C(S) -NH2; n = 0-3], MX2•HL•n H2O [M = Ni, Cu; n = 0, 1], and ML'2•nH2O [M = Co, Ni, Zn; n = 0-3]. The same reactions in the presence of amines (A = C5H 5N, 2-CH3C5H4N, 3-CH 3C5H4N, 4-CH3C5H 4N) afford complexes of the composition CuALCl and MALX•n H 2O [M = Cu, Ni; X = Cl, NO3; n = 0-2]. Structure of the coordination node in the amine-containing copper derivatives is polynuclear, in complexes Cu(HL)(L)2 is octahedral, in other compounds it is tetrahedral. The azomethines (HL and HL') in these complexes behave as bidentate N,O and N,S ligands. Thermolysis of the complexes includes a step of dehydration (60-90°C) and complete thermal decomposition (430-590°C).Item COBALT, NICKEL, AND COPPER COORDINATION COMPOUNDS WITH 3-PHENYLPROPENAL BENZOYLHYDRAZONE(2006) Samusi, Nina; Gulea, Aurelian; Țapcov, Victor3-Phenylpropenal benzoylhydrazone (HL) reacts with cobalt, nickel, and copper chlorides, nitrates, and acetates to give coordination compounds MX 2 • nH2O [M = Co, Ni, Cu; X = Cl, NO3, HL = C6H5CH=CHCH=NNHC(O)C6H5; n = 0, 2] and ML2 • nH2O (M = Co, Ni, Cu; n = 1-3). Complexes MALCI (M = Co, Ni, Cu) were obtained by these reactions in the presence of amines (A = C5H5N, 2-CH3C5H 4N, 3-CH3C5H4N, 4-CH 3C5H4N). All the compounds have a monomeric structure. Azomethine (HL) in them behaves as a bidentate N,O-ligand. Thermolysis of the complexes involves the stages of dehydration (70-90°C), deaquation (145-155°C) or deamination (145-185°C), and complete thermal decomposition (330-490°C).Item SULFANILAMIDE-CONTAINING COORDINATION COMPOUNDS OF Cu (II) WITH ISATIN AND N-METHYLISATIN THIOSEMICARBAZONES(2006) Gulea, Aurelian; Spînu, S.; Țapcov, Victor; Poirier, Donald; Roy, JennyIsatin (L1) and N-methylisatin (L2) β-thiosemicarbazones react in ethanol with Cu(II) chloride and bromide in the presence of sulfanilamide (Streptocid, Sf1), N′- acetylsulfanilamide (Sulfacyl, Sf2), Norsulfazole (Sf3), Aethazolum (Sf4), and Sulfadimesine (Sf5) to form coordination compounds Cu(Sf1-5)L1-2X2· nH2O (X = Cl, Br; n = 2-5). All the complexes have a monomeric structure. Thiosemicarbazones L1 and L2 in these complexes are tridentate O,N,S ligands, and sulfanilamides Sf1-5 are monodentate ligands. Thermolysis of the substances involves the steps of dehydration (70-95°C) and complete decomposition (410-530°C).Item COORDINATION COMPOUNDS OF COBALT, NICKEL, COPPER AND ZINC WITH THIOSEMICARBAZONE AND 3-PHENYLPROPENAL SEMICARBAZONE(2006) Samusi, Nina; Gulea, Aurelian; Țapcov, Victor; Ciumacov, Iurie; Roșu, TudorHydrates of 3-phenylpropenal thiosemicarbazone (HL•H2O) and semicarbazone (HL'•H2O) react in methanol with cobalt, nickel, copper, and zinc chlorides, nitrates, and acetates to form coordination compounds MX2•2HL•nSolv [M = Co, Ni, Cu, Zn; X = Cl, NO3; HL = C6H5CH=CH-CH=N-NHC(O)NH2; n = 0-3; Solv = H2O, CH3OH], CuX2•HL• nH2O [M = Ni, Cu; n = 0, 1], ML2•nH2O and ML'•nH2O [M = Co, Ni, Zn; HL' = C6H 5CH=CH-CH=N-NHC(O)NH2; n = 0-3]. In the presence of amines (A = C5H5N, 2-CH3C5H4N, 3-CH3C5H4N, and 4-CH3C 5H4N) these reactions yield the complexes Cu(A)LCl•CH3OH and M(A)LX•nH2O [M = Cu, Ni; X = Cl, NO3; n = 0-2]. The copper complexes with the amine ligands are of polynuclear structure, and other complexes are monomeric. Carbazones (HL and HL') are included in the complexes as bidentate N,S-and N,O-ligands. The thermolysis of the complexes involves the stages of removing solvent crystallization molecules (70-90°C), deaquation (150-170°C), and full thermal decomposition (500-580°C).