Browsing by Author "Bocelli, Gabrielle"
Now showing 1 - 7 of 7
- Results Per Page
- Sort Options
Item Coordination compounds of cobalt, nickel, copper, and zinc with 2-bromo-3-phenylpropenal benzoylhydrazone and thiosemicarbazone [Articol](2009) Samusi, Nina; Ciumacov, Iurie; Țapcov, Victor; Bocelli, Gabrielle; Simonov, Iurie; Gulea, AurelianBy X-ray structural analysis the crystal structure of 2-bromo-3- phenylpropenal benzoylhydrazone (HL) was determined. The molecule is not flat. In the crystal the HL molecules form infinite chains with reciprocal van der Waals interaction. 2-Bromo-3-phenylpropenal hydrazone (HL) and thiosemicarbazone (HL') react with cobalt, nickel, copper and zinc chlorides, nitrates and acetates to form coordination compounds of the composition Cu(HL)(L)2 [HL = C6H5-CH=CBr-CH=N-NH-C(O)-C6H 5], MX2•2 HL'•nH2O [M = Co, Ni, Cu, Zn; X = Cl, NO3, HL' = C6H5-CH=CBr-CH=N-NH-C(S) -NH2; n = 0-3], MX2•HL•n H2O [M = Ni, Cu; n = 0, 1], and ML'2•nH2O [M = Co, Ni, Zn; n = 0-3]. The same reactions in the presence of amines (A = C5H 5N, 2-CH3C5H4N, 3-CH 3C5H4N, 4-CH3C5H 4N) afford complexes of the composition CuALCl and MALX•n H 2O [M = Cu, Ni; X = Cl, NO3; n = 0-2]. Structure of the coordination node in the amine-containing copper derivatives is polynuclear, in complexes Cu(HL)(L)2 is octahedral, in other compounds it is tetrahedral. The azomethines (HL and HL') in these complexes behave as bidentate N,O and N,S ligands. Thermolysis of the complexes includes a step of dehydration (60-90°C) and complete thermal decomposition (430-590°C).Item Coordination compounds of copper (II) nitrate with products of aminotris(hydroxymethyl)methane condensation with salicyl- and 5-nitrosalicylaldehydes: Synthesis and crystal structures [Articol](2005) Ciumacov, Iurie; Țapcov, Victor; Simonov, Iurie; Antoșciac, Boris; Bocelli, Gabrielle; Perrin, Monique; Starnicova, Zoia; Samusi, Nina; Gulea, AurelianThe crystal structures of copper(II) nitrate complexes with 2-(2-hydroxybenzylideneamino)-2-hydroxymethylpropane-1,3-diol (HL) and 2-hydroxymethyl-2-(2-hydroxy-5-nitrobenzylideneamino)propane-1,3-diol (HL 1) were determined. The resulting complexes were formulated as [Cu3OL3(H2O2]NO3 • 3H2O (I) and [Cu(H2O)L1]NO3 (II). The crystals of I are monoclinic, a = 17.809(4) Å, b = 30.549(6) Å, c = 18.962(4) Å, β = 115.36(3)°, space group Cc, Z = 8, R = 0.0482. Complex I is composed of two independent three-dimensional μ 3-oxo complexes; the coordination polyhedron of the copper atoms in both compounds is an elongated tetragonal bipyramid. The coordination polyhedron of the third Cu atom is a tetragonal pyramid. The bases of the pyramids are composed of the oxygen atoms of the phenol and alcohol OH groups, the imine N atom of ligand L, and μ 3-oxo atoms. The phenol and water O atoms serve as the apices in both the tetragonal bipyramids. The crystals of II are triclinic, a = 6.062(1) Å, b = 7.701(2) Å, c = 16.162(3) ̊, α = 88.15(3)°, β = 84.94(3)°, γ = 78.13(3)°, space group P1̄, Z = 2, R = 0.0272. Complex II is composed of polymer chains formed by coordination bonds between the copper atom and two O atoms of the amino alcohol in the azomethine of the neighboring complex connected to the initial one by translation along the x axis. These chains are linked through hydrogen bonds involving the oxygen atoms of the NO2 groups. The benzene rings of the azomethine ligands of the adjoining complexes from different chains are antiparallel to each other. The coordination polyhedron of the central atom is an elongated tetragonal bipyramid. Its equatorial plane is formed by the phenol O atom, one of the alcohol O atoms, the N atom of ligand L1, and the O atom of the amino alcohol in the neighboring complex. The apices are the O atom of the water molecule and the O atom of the amino alcohol in the neighboring azomethine molecule. In complexes I and II, the outer-sphere nitrato group mainly serves to unite trimers and polymers in the crystal by means of hydrogen bonds.Item Crystal structure of 4,4-bipyridine-containing complexes of copper(II) nitrate with 1-[(2-Hydroxyethylimino)methyl]naphthalen-2-ol and 2-[(2-hydroxyethylimino)methyl]phenol [Articol](2009) Ciumacov, Iurie; Țapcov, Victor; Petrenko, Peter A.; Popovschi, Liliana; Simonov, Iurie; Bocelli, Gabrielle; Antoșciac, Boris; Paraschivescu, Andrei; Gulea, AurelianThe crystal structures of (μ-4,4-bipyridine)-di(nitrato-1-[(2- hydroxyethylimino)methyl]naphthalen-2-olocopper (I) and catena-di(μ-4,4'- bipyridine)di(μ-4,4'-bipyridine)-di(nitrato-2-[2-(hydroxyethylimino) methyl]phenolocopper)diaquacopper(II) nitrate (II) were determined. In the crystal of I, each of the two copper atoms coordinates a singly deprotonated tridentate azomethine molecule, a nitrate ion, and bipyridine, which functions as a bridge between the central atoms. The copper coordination polyhedron is a slightly distorted tetragonal pyramid with the base formed by the imine and bipyridine nitrogen atoms and the phenol and alcohol oxygen atoms. The axial site in the pyramid is occupied by the oxygen atom of the monodentate nitrate groups. In the trinuclear structure II with C2 crystal chemical symmetry, the terminal coordination unit is composed through copper coordination of monodeprotonated 2-[2-(hydroxyethylimino)methyl]phenol, bipyridine, and the nitrate anion. In the crystal, the trinuclear molecules form infinite ribbons along the z axis in which the pyridine molecules perform the bridging function. The central copper atom has an octahedral configuration formed by the nitrogen atoms of four 4,4'-bipyridine molecules and oxygen of two water moleculesItem Crystal structures of 3-phenylpropenal thiosemicarbazone and its nickel and zinc chelates [Articol](2006) Ciumacov, Iurie; Samusi, Nina; Bocelli, Gabrielle; Suponițchi, Chiril; Țapcov, Victor; Gulea, Aurelian3-Phenylpropenal thiosemicarbazone hydrate C6H 5-HC=CH-CH=N-NH-C(S)-NH2 • H2O (HL • H2O, I) and two chelates [Ni(L)2] • nCH3OH (II) and [Zn(L)2] (III) are studied by X-ray diffraction. The crystals of I are orthorhombic: a = 6.227(1) Å, b = 7.763(2) Å, c = 25.585(5) Å, β = 90°, space group P212 121, Z = 4, R = 0.0426. A nonplanar molecule of I has an E conformation. The crystals of II are triclinic: a = 6.551(2) Å, b = 10.752(3) Å, c = 10.885(3) Å, α = 64.751(5)°, β = 82.753(5)°, γ = 89.857(5)°, space group, Z = 1, R = 0.0661. In a centrosymmetric molecule of II, the central atom coordinates two deprotonated ligands L through the immine nitrogen atom and thioamide sulfur atom at the vertices of a distorted square. The crystals of III are monoclinic: a = 25.342(2) Å, b = 9.150(2) Å, c = 21.340(3) Å, α = 90°, β = 111.84(2)°, γ = 90°, space group C2/c, Z = 8, R = 0.0556. In a molecule of complex III, two deprotonated bidentate ligands L are coordinated by the zinc ion through the immine nitrogen atoms and thioamide sulfur atoms to form a distorted tetrahedron at the central atom. In both II and III, ligand L after coordination by the metal ion changes the E conformation with respect to the N(1)-C(2) bond for the Z conformation. In crystals I-III, molecules are packed to form infinite layers parallel to the planes (001) and (010)Item Crystal structures of nitrato-{4-bromo-2-[(2-hydroxyethylimion)methyl] phenolo}-(3,5-dibromopyridine)copper and nitrato-{2,4-dibromo-6-[(2- hydroxyethylimino)methyl]phenolo}-(3,5-dibromopyridine)copper [Articol](2006) Ciumacov, Iurie; Țapcov, Victor; Bocelli, Gabrielle; Neburger, Markus; Gulea, AurelianThe crystal structures of nitrato-{4-bromo-2-[2-hydroxyethylimino)methyl] phenolo}-(3,5-dibromopyridine)copper (I) and nitrato-{2,4-dibromo-6-[(2- hydroxyethylimino)methyl]phenolo}-(3,5-dibromopyridine)copper (II) are determined. The crystals of compound I are orthorhombic: a = 14.157(3) Å, b = 15.420(3) Å, c = 17.494(4) Å, space group Pbca, Z = 8, R = 0.067. The crystals of compound II are monoclinic: a = 10.675 Å, b = 13.973 Å, c = 14.007 Å, β = 111.92°, space group P2 1/n, Z = 4, R = 0.0464. In the structures of compounds I and II, the copper atom coordinates, correspondingly, singly deprotonated 4-bromo-2-[(2-hydroxyethylimino)methyl]phenol and 2,4-dibromo-6-[(2- hydroxyethylimino)methyl]phenol molecules, and 3,5-dibromopyridine, and the nitrate ion. The coordination polyhedron of the copper ion in complexes I and II is a slightly distorted tetragonal pyramid. The bases of the pyramids are formed by the imine and pyridine nitrogen atoms and the phenolic and alcoholic oxygen atoms, and the axial vertices are occupied by the oxygen atoms of the monodentate nitrato groups. In the complexes under study, the six-membered metallocycles have asymmetric gauche conformation. In crystal, complexes I are united, due to the slip plane a, through bifurcate hydrogen bonds into infinite chains along the direction [100]. Complexes II in crystal form two-dimensional networks by means of hydrogen bonds.Item Synthesis and structure of Di(μ-O phenoxy)-bisnitrato-2-[2- (hydroxyethylimino)-methyl]-phenoloimidazolecopper [Articol](2004) Ciumacov, Iurie; Antoșciac, Boris; Țapcov, Victor; Bocelli, Gabrielle; Gulea, AurelianThe crystal structure of di(μ-O phenoxy)-bisnitrato-2-[2- (hydroxyethylimino)-methyl]-phenoloimid-azolecopper was determined. The crystals are monoclinic: a = 10.222(2) , b = 13.810(3) , c = 10.620(2) , β =103.67(3)°, space group P2 1/n, Z = 2, R = 0.050. The copper atom coordinates the singly deprotonated 2-[2-(hydroxyethylimino)-methyl]-phenol molecule, imidazole, and nitrate ion. The coordination polyhedron of the central atom is an extended tetragonal bipyramid with imine and imidazole nitrogen atoms and phenol and alcohol oxygen atoms lying in its base. One axial vertex of the bipyramid is occupied by the oxygen atom of the nitrato group and the other vertex, by phenol oxygen atom of the neighboring complex joined with the initial complex by the symmetry center. Two bridging phenol oxygen atoms unite the complexes into a centrosymmetrical dimer.Item Synthesis, structure and properties of some 3d-element complexes with 2-[2-(hydroxybenzylidene)-amino]-2-hydoxymethylpropane-1,3-diol [Articol](2004) Țapcov, Victor; Ciumacov, Iurie; Antoșciac, Boris; Bocelli, Gabrielle; Samusi, Nina; Gulea, Aurelian2-[2-(Hydroxybenzylidene)-amino]-2-hydoxymethylpropane-1,3-diol (HL) reacts with cobalt, nickel, copper and zinc chlorides, bromides and acetates in water-ethanol solutions and gives MLX·nH2O and ML 2·nH2O complexes (M = Co, Ni, Cu, Zn; X = Cl, Br; n = 0-5). Single crystals of CuLBr were grown, and its crystal structure was determined by X-ray diffraction analysis. The crystals are tetragonal, a = 17.024(2), c = 8.720(2) Å, space group P421c, Z = 8, R 1 = 0.0349. In the structure of this complex, the copper atom coordinates the deprotonated HL molecule. The coordination polyhedron of the central atom is an elongated tetragonal pyramid. Its base is built of the imine nitrogen atom, phenolic and alcoholic oxygen atoms, and bromine atom. The apex of the pyramid is occupied by the bromine atom of the adjacent complex connected with the initial complex by the plane of sliding reflection. Thus, the crystal contains infinite chains of complexes running along the c axis, the complexes being united by both bridging bromine atoms and O-H⋯O hydrogen bonds. The conclusions on the compositions and structures of the remaining compounds were made on the basis of elemental and combined thermal analyses, IR spectroscopy, and magnetic chemistry data. The copper halide complexes were found to have dimeric, and the other metal complexes monomeric, structures. In the synthesized complexes, the azomethine HL can function as a bidentate or tridentate ligand. The thermolysis of the coordination compounds proceeds through the stages of elimination of crystal water molecules (75-90°C) or inner-sphere water molecules (145-155°C) and complete thermal destruction (485-550°C).